C32H24N5O3+ — CID 87391416
2-[[3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 87391416) has the molecular formula C32H24N5O3+ and a molecular weight of 526.58 g/mol. Its IUPAC name is 2-[[3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87391416 |
| Molecular Formula | C32H24N5O3+ |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2-[[3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | N[N+]12C=CN=CC1=C(C1=CC=C1)N=C2c1cccc(OCc2cccc(CN3C(=O)c4ccccc4C3=O)c2)c1 |
| InChI | InChI=1S/C32H24N5O3/c33-37-15-14-34-18-28(37)29(23-8-4-9-23)35-30(37)24-10-5-11-25(17-24)40-20-22-7-3-6-21(16-22)19-36-31(38)26-12-1-2-13-27(26)32(36)39/h1-18H,19-20,33H2/q+1 |
| InChIKey | JNMLTDRLCCWYRX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|