C27H22N5O2+ — CID 87391269
1-(cyclobutadienyl)-3-[3-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87391269) has the molecular formula C27H22N5O2+ and a molecular weight of 448.51 g/mol. Its IUPAC name is 1-(cyclobutadienyl)-3-[3-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-(cyclobutadienyl)-3-[3-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87391269 |
| Molecular Formula | C27H22N5O2+ |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-(cyclobutadienyl)-3-[3-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | Cc1onc(-c2ccccc2)c1COc1cccc(C2=NC(C3=CC=C3)=C3C=NC=C[N+]23N)c1 |
| InChI | InChI=1S/C27H22N5O2/c1-18-23(25(31-34-18)19-7-3-2-4-8-19)17-33-22-12-6-11-21(15-22)27-30-26(20-9-5-10-20)24-16-29-13-14-32(24,27)28/h2-16H,17,28H2,1H3/q+1 |
| InChIKey | WOHMZTALAHSARS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|