C24H18N5O+ — CID 87391195
2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]benzonitrile (PubChem CID 87391195) has the molecular formula C24H18N5O+ and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 87391195 |
| Molecular Formula | C24H18N5O+ |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1cccc(C2=NC(C3=CC=C3)=C3C=NC=C[N+]23N)c1 |
| InChI | InChI=1S/C24H18N5O/c25-14-19-5-1-2-6-20(19)16-30-21-10-4-9-18(13-21)24-28-23(17-7-3-8-17)22-15-27-11-12-29(22,24)26/h1-13,15H,16,26H2/q+1 |
| InChIKey | IDANVMFEWNNDPA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|