C8H11Br2N3O — CID 87370694
3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine (PubChem CID 87370694) has the molecular formula C8H11Br2N3O and a molecular weight of 325.00 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine.
| Compound Name | 3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 87370694 |
| Molecular Formula | C8H11Br2N3O |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 3,5-dibromo-N-(2-methoxyethyl)-N-methylpyrazin-2-amine |
| SMILES | COCCN(C)c1ncc(Br)nc1Br |
| InChI | InChI=1S/C8H11Br2N3O/c1-13(3-4-14-2)8-7(10)12-6(9)5-11-8/h5H,3-4H2,1-2H3 |
| InChIKey | HUYRKVCXBBDLQR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |