C27H36N2O5S3 — CID 87373424
[1-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]-2-methoxy-2-oxo-1-phenylethyl] propanoate (PubChem CID 87373424) has the molecular formula C27H36N2O5S3 and a molecular weight of 564.80 g/mol. Its IUPAC name is [1-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]-2-methoxy-2-oxo-1-phenylethyl] propanoate.
| Compound Name | [1-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]-2-methoxy-2-oxo-1-phenylethyl] propanoate |
|---|---|
| PubChem CID | 87373424 |
| Molecular Formula | C27H36N2O5S3 |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [1-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]-2-methoxy-2-oxo-1-phenylethyl] propanoate |
| SMILES | CCC(=O)OC(NC(=O)C(CSSCC(N)CCSC)Cc1ccccc1)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C27H36N2O5S3/c1-4-24(30)34-27(26(32)33-2,22-13-9-6-10-14-22)29-25(31)21(17-20-11-7-5-8-12-20)18-36-37-19-23(28)15-16-35-3/h5-14,21,23H,4,15-19,28H2,1-3H3,(H,29,31) |
| InChIKey | QJVHDDFJDZTNRB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|