C26H39F3N2O7S3 — CID 171930429
[1-[2-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]acetyl]oxy-2-methylpropyl] propanoate;2,2,2-trifluoroacetic acid (PubChem CID 171930429) has the molecular formula C26H39F3N2O7S3 and a molecular weight of 644.80 g/mol. Its IUPAC name is [1-[2-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]acetyl]oxy-2-methylpropyl] propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [1-[2-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]acetyl]oxy-2-methylpropyl] propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171930429 |
| Molecular Formula | C26H39F3N2O7S3 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | [1-[2-[[2-[[(2-amino-4-methylsulfanylbutyl)disulfanyl]methyl]-3-phenylpropanoyl]amino]acetyl]oxy-2-methylpropyl] propanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=O)OC(OC(=O)CNC(=O)C(CSSCC(N)CCSC)Cc1ccccc1)C(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H38N2O5S3.C2HF3O2/c1-5-21(27)30-24(17(2)3)31-22(28)14-26-23(29)19(13-18-9-7-6-8-10-18)15-33-34-16-20(25)11-12-32-4;3-2(4,5)1(6)7/h6-10,17,19-20,24H,5,11-16,25H2,1-4H3,(H,26,29);(H,6,7) |
| InChIKey | CFIKJIYJSURACF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|