C21H33F3N2O7S4 — CID 173139382
1,3-dihydroxypropan-2-yl 3-[[2-[[(3-methylsulfanylpropylamino)methyldisulfanyl]methyl]-3-thiophen-3-ylpropanoyl]amino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 173139382) has the molecular formula C21H33F3N2O7S4 and a molecular weight of 610.76 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 3-[[2-[[(3-methylsulfanylpropylamino)methyldisulfanyl]methyl]-3-thiophen-3-ylpropanoyl]amino]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 1,3-dihydroxypropan-2-yl 3-[[2-[[(3-methylsulfanylpropylamino)methyldisulfanyl]methyl]-3-thiophen-3-ylpropanoyl]amino]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173139382 |
| Molecular Formula | C21H33F3N2O7S4 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 3-[[2-[[(3-methylsulfanylpropylamino)methyldisulfanyl]methyl]-3-thiophen-3-ylpropanoyl]amino]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | CSCCCNCSSCC(Cc1ccsc1)C(=O)NCCC(=O)OC(CO)CO.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H32N2O5S4.C2HF3O2/c1-27-7-2-5-20-14-30-29-13-16(9-15-4-8-28-12-15)19(25)21-6-3-18(24)26-17(10-22)11-23;3-2(4,5)1(6)7/h4,8,12,16-17,20,22-23H,2-3,5-7,9-11,13-14H2,1H3,(H,21,25);(H,6,7) |
| InChIKey | CINZNORVUMZLCZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|