C23H35NO5S3 — CID 154981232
1-(1-ethoxyethenoxy)ethyl 2-[[2-benzyl-3-(4-methylsulfanylbutyldisulfanyl)propanoyl]amino]acetate (PubChem CID 154981232) has the molecular formula C23H35NO5S3 and a molecular weight of 501.74 g/mol. Its IUPAC name is 1-(1-ethoxyethenoxy)ethyl 2-[[2-benzyl-3-(4-methylsulfanylbutyldisulfanyl)propanoyl]amino]acetate.
| Compound Name | 1-(1-ethoxyethenoxy)ethyl 2-[[2-benzyl-3-(4-methylsulfanylbutyldisulfanyl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 154981232 |
| Molecular Formula | C23H35NO5S3 |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 1-(1-ethoxyethenoxy)ethyl 2-[[2-benzyl-3-(4-methylsulfanylbutyldisulfanyl)propanoyl]amino]acetate |
| SMILES | C=C(OCC)OC(C)OC(=O)CNC(=O)C(CSSCCCCSC)Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO5S3/c1-5-27-18(2)28-19(3)29-22(25)16-24-23(26)21(15-20-11-7-6-8-12-20)17-32-31-14-10-9-13-30-4/h6-8,11-12,19,21H,2,5,9-10,13-17H2,1,3-4H3,(H,24,26) |
| InChIKey | UQNYAWZUUIVINU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|