C22H32N2O12S3-2 — CID 175117211
5-amino-2-benzyl-1-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinate (PubChem CID 175117211) has the molecular formula C22H32N2O12S3-2 and a molecular weight of 612.70 g/mol. Its IUPAC name is 5-amino-2-benzyl-1-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinate.
| Compound Name | 5-amino-2-benzyl-1-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinate |
|---|---|
| PubChem CID | 175117211 |
| Molecular Formula | C22H32N2O12S3-2 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 5-amino-2-benzyl-1-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinate |
| SMILES | CCOC(=O)OC(C)OC(=O)CNC(=O)C(Cc1ccccc1)CC(C(N)CCS(C)(=O)=O)(S(=O)[O-])S(=O)[O-] |
| InChI | InChI=1S/C22H34N2O12S3/c1-4-34-21(27)36-15(2)35-19(25)14-24-20(26)17(12-16-8-6-5-7-9-16)13-22(37(28)29,38(30)31)18(23)10-11-39(3,32)33/h5-9,15,17-18H,4,10-14,23H2,1-3H3,(H,24,26)(H,28,29)(H,30,31)/p-2 |
| InChIKey | SEEWZYZXYAQMTD-UHFFFAOYSA-L |
| XLogP | -0.37 |
| TPSA | 231.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|