C24H38N2O13S3 — CID 175105910
5-amino-2-benzyl-1-[[1-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-1-oxobutan-2-yl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinic acid (PubChem CID 175105910) has the molecular formula C24H38N2O13S3 and a molecular weight of 658.77 g/mol. Its IUPAC name is 5-amino-2-benzyl-1-[[1-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-1-oxobutan-2-yl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinic acid.
| Compound Name | 5-amino-2-benzyl-1-[[1-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-1-oxobutan-2-yl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinic acid |
|---|---|
| PubChem CID | 175105910 |
| Molecular Formula | C24H38N2O13S3 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | 5-amino-2-benzyl-1-[[1-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-1-oxobutan-2-yl]amino]-7-methylsulfonyl-1-oxoheptane-4,4-disulfinic acid |
| SMILES | CCOC(=O)OC(C)OC(=O)C(NC(=O)C(Cc1ccccc1)CC(C(N)CCS(C)(=O)=O)(S(=O)O)S(=O)O)C(C)O |
| InChI | InChI=1S/C24H38N2O13S3/c1-5-37-23(30)39-16(3)38-22(29)20(15(2)27)26-21(28)18(13-17-9-7-6-8-10-17)14-24(40(31)32,41(33)34)19(25)11-12-42(4,35)36/h6-10,15-16,18-20,27H,5,11-14,25H2,1-4H3,(H,26,28)(H,31,32)(H,33,34) |
| InChIKey | VWMZENOEZBHXLX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 245.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|