C22H36N2O14S4 — CID 175352929
5-amino-7-methylsulfonyl-1-oxo-1-[[1-oxo-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]propan-2-yl]amino]-2-(thiophen-3-ylmethyl)heptane-4,4-disulfinic acid (PubChem CID 175352929) has the molecular formula C22H36N2O14S4 and a molecular weight of 680.80 g/mol. Its IUPAC name is 5-amino-7-methylsulfonyl-1-oxo-1-[[1-oxo-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]propan-2-yl]amino]-2-(thiophen-3-ylmethyl)heptane-4,4-disulfinic acid.
| Compound Name | 5-amino-7-methylsulfonyl-1-oxo-1-[[1-oxo-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]propan-2-yl]amino]-2-(thiophen-3-ylmethyl)heptane-4,4-disulfinic acid |
|---|---|
| PubChem CID | 175352929 |
| Molecular Formula | C22H36N2O14S4 |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.10 |
| IUPAC Name | 5-amino-7-methylsulfonyl-1-oxo-1-[[1-oxo-1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]propan-2-yl]amino]-2-(thiophen-3-ylmethyl)heptane-4,4-disulfinic acid |
| SMILES | CC(NC(=O)C(Cc1ccsc1)CC(C(N)CCS(C)(=O)=O)(S(=O)O)S(=O)O)C(=O)OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C22H36N2O14S4/c1-11(20(29)37-9-14-16(25)17(26)18(27)21(30)38-14)24-19(28)13(7-12-3-5-39-10-12)8-22(40(31)32,41(33)34)15(23)4-6-42(2,35)36/h3,5,10-11,13-18,21,25-27,30H,4,6-9,23H2,1-2H3,(H,24,28)(H,31,32)(H,33,34) |
| InChIKey | AVEXNNLQBFZESD-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 280.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|