C28H39N2O8P — CID 91129964
1-aminoethyl-[3-[[4-(1-ethoxycarbonyloxyethoxy)-3-methyl-4-oxobutan-2-yl]amino]-3-oxo-2-[(4-phenylphenyl)methyl]propyl]phosphinic acid (PubChem CID 91129964) has the molecular formula C28H39N2O8P and a molecular weight of 562.60 g/mol. Its IUPAC name is 1-aminoethyl-[3-[[4-(1-ethoxycarbonyloxyethoxy)-3-methyl-4-oxobutan-2-yl]amino]-3-oxo-2-[(4-phenylphenyl)methyl]propyl]phosphinic acid.
| Compound Name | 1-aminoethyl-[3-[[4-(1-ethoxycarbonyloxyethoxy)-3-methyl-4-oxobutan-2-yl]amino]-3-oxo-2-[(4-phenylphenyl)methyl]propyl]phosphinic acid |
|---|---|
| PubChem CID | 91129964 |
| Molecular Formula | C28H39N2O8P |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 1-aminoethyl-[3-[[4-(1-ethoxycarbonyloxyethoxy)-3-methyl-4-oxobutan-2-yl]amino]-3-oxo-2-[(4-phenylphenyl)methyl]propyl]phosphinic acid |
| SMILES | CCOC(=O)OC(C)OC(=O)C(C)C(C)NC(=O)C(Cc1ccc(-c2ccccc2)cc1)CP(=O)(O)C(C)N |
| InChI | InChI=1S/C28H39N2O8P/c1-6-36-28(33)38-21(5)37-27(32)18(2)19(3)30-26(31)25(17-39(34,35)20(4)29)16-22-12-14-24(15-13-22)23-10-8-7-9-11-23/h7-15,18-21,25H,6,16-17,29H2,1-5H3,(H,30,31)(H,34,35) |
| InChIKey | BIIIPSMWTHXPOE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|