C29H44N2O11S3 — CID 122193078
1-[[(2S)-1-[[(2S)-2-benzyl-3-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-3-oxopropyl]disulfanyl]-4-methylsulfinylbutan-2-yl]carbamoyloxy]ethyl 2-methylpropanoate (PubChem CID 122193078) has the molecular formula C29H44N2O11S3 and a molecular weight of 692.88 g/mol. Its IUPAC name is 1-[[(2S)-1-[[(2S)-2-benzyl-3-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-3-oxopropyl]disulfanyl]-4-methylsulfinylbutan-2-yl]carbamoyloxy]ethyl 2-methylpropanoate.
| Compound Name | 1-[[(2S)-1-[[(2S)-2-benzyl-3-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-3-oxopropyl]disulfanyl]-4-methylsulfinylbutan-2-yl]carbamoyloxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 122193078 |
| Molecular Formula | C29H44N2O11S3 |
| Molecular Weight | 692.88 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | 1-[[(2S)-1-[[(2S)-2-benzyl-3-[[2-(1-ethoxycarbonyloxyethoxy)-2-oxoethyl]amino]-3-oxopropyl]disulfanyl]-4-methylsulfinylbutan-2-yl]carbamoyloxy]ethyl 2-methylpropanoate |
| SMILES | CCOC(=O)OC(C)OC(=O)CNC(=O)[C@@H](CSSC[C@H](CCS(C)=O)NC(=O)OC(C)OC(=O)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C29H44N2O11S3/c1-7-38-29(36)42-20(4)39-25(32)16-30-26(33)23(15-22-11-9-8-10-12-22)17-43-44-18-24(13-14-45(6)37)31-28(35)41-21(5)40-27(34)19(2)3/h8-12,19-21,23-24H,7,13-18H2,1-6H3,(H,30,33)(H,31,35)/t20?,21?,23-,24+,45?/m1/s1 |
| InChIKey | UVTAIEXQFOJKMH-WMLRLSGBSA-N |
| XLogP | 3.81 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|