About bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate
bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate (PubChem CID 87375893) has the molecular formula C16H34O6Si2
and a molecular weight of 378.61 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate |
| PubChem CID | 87375893 |
| Molecular Formula | C16H34O6Si2 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate |
| SMILES | CC(C)C(O)(C(=O)O[Si](C)(C)C)C(O)(C(=O)O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C16H34O6Si2/c1-11(2)15(19,13(17)21-23(5,6)7)16(20,12(3)4)14(18)22-24(8,9)10/h11-12,19-20H,1-10H3 |
| InChIKey | CPGWUAWQTLPLRE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate?
The IUPAC name of bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate (CID 87375893) is bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate.
What is the SMILES notation for bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate?
The canonical SMILES for bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate is CC(C)C(O)(C(=O)O[Si](C)(C)C)C(O)(C(=O)O[Si](C)(C)C)C(C)C.
What is the InChIKey of bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate?
The InChIKey is CPGWUAWQTLPLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O6Si2/c1-11(2)15(19,13(17)21-23(5,6)7)16(20,12(3)4)14(18)22-24(8,9)10/h11-12,19-20H,1-10H3.
What are the key properties of bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate?
bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate has a molecular weight of 378.61 g/mol, XLogP of 2.52, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) 2,3-dihydroxy-2,3-di(propan-2-yl)butanedioate is sourced from PubChem (CID 87375893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).