C29H38N4O3 — CID 87379321
N-(2-morpholin-4-ylethyl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)-8-oxodecanamide (PubChem CID 87379321) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)-8-oxodecanamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)-8-oxodecanamide |
|---|---|
| PubChem CID | 87379321 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)-8-oxodecanamide |
| SMILES | CCC(=O)CCCCCC(C(=O)NCCN1CCOCC1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C29H38N4O3/c1-2-25(34)10-4-3-5-11-26(29(35)30-14-15-33-16-18-36-19-17-33)28-31-21-27(32-28)24-13-12-22-8-6-7-9-23(22)20-24/h6-9,12-13,20-21,26H,2-5,10-11,14-19H2,1H3,(H,30,35)(H,31,32) |
| InChIKey | GRWXOBPGWOXLJM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|