C20H20Cl8N4O3S — CID 87379983
1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate (PubChem CID 87379983) has the molecular formula C20H20Cl8N4O3S and a molecular weight of 680.10 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate.
| Compound Name | 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 87379983 |
| Molecular Formula | C20H20Cl8N4O3S |
| Molecular Weight | 680.10 g/mol |
| Exact Mass | 675.88 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)SCC(Cl)=C(Cl)Cl)C(C)C.O=C(O)c1nc(C(Cl)(Cl)Cl)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H4Cl5N3O2.C10H16Cl3NOS/c11-4-1-2-6(5(12)3-4)18-9(10(13,14)15)16-7(17-18)8(19)20;1-6(2)14(7(3)4)10(15)16-5-8(11)9(12)13/h1-3H,(H,19,20);6-7H,5H2,1-4H3 |
| InChIKey | AZFVDUMNYKKAJH-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.10 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|