C27H38F3N5O3S2 — CID 87385662
(2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (PubChem CID 87385662) has the molecular formula C27H38F3N5O3S2 and a molecular weight of 601.76 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 87385662 |
| Molecular Formula | C27H38F3N5O3S2 |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCCCCCCN(CCc1csc(SC(C)(C)C(=O)OC(=O)C(F)(F)F)n1)c1ncc(N2CCCCC2)cn1 |
| InChI | InChI=1S/C27H38F3N5O3S2/c1-4-5-6-7-9-15-35(24-31-17-21(18-32-24)34-13-10-8-11-14-34)16-12-20-19-39-25(33-20)40-26(2,3)22(36)38-23(37)27(28,29)30/h17-19H,4-16H2,1-3H3 |
| InChIKey | WJVKUMHPWCBPOK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|