C14H9ClO2 — CID 87386547
6-chloro-2-cyclopenta-1,3-dien-1-ylchromen-4-one (PubChem CID 87386547) has the molecular formula C14H9ClO2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 6-chloro-2-cyclopenta-1,3-dien-1-ylchromen-4-one.
| Compound Name | 6-chloro-2-cyclopenta-1,3-dien-1-ylchromen-4-one |
|---|---|
| PubChem CID | 87386547 |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-chloro-2-cyclopenta-1,3-dien-1-ylchromen-4-one |
| SMILES | O=c1cc(C2=CC=CC2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H9ClO2/c15-10-5-6-13-11(7-10)12(16)8-14(17-13)9-3-1-2-4-9/h1-3,5-8H,4H2 |
| InChIKey | VEJCGGGEVBTJOJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |