C11H5ClF4O2 — CID 715720
6-chloro-2-(1,1,2,2-tetrafluoroethyl)chromen-4-one (PubChem CID 715720) has the molecular formula C11H5ClF4O2 and a molecular weight of 280.60 g/mol. Its IUPAC name is 6-chloro-2-(1,1,2,2-tetrafluoroethyl)chromen-4-one.
| Compound Name | 6-chloro-2-(1,1,2,2-tetrafluoroethyl)chromen-4-one |
|---|---|
| PubChem CID | 715720 |
| Molecular Formula | C11H5ClF4O2 |
| Molecular Weight | 280.60 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 6-chloro-2-(1,1,2,2-tetrafluoroethyl)chromen-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)F)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C11H5ClF4O2/c12-5-1-2-8-6(3-5)7(17)4-9(18-8)11(15,16)10(13)14/h1-4,10H |
| InChIKey | UHWSPHBDHYBDDQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|