C21H19N — CID 87390387
3-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,4,7,9,11,13,17-heptaene (PubChem CID 87390387) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,4,7,9,11,13,17-heptaene.
| Compound Name | 3-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,4,7,9,11,13,17-heptaene |
|---|---|
| PubChem CID | 87390387 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,4,7,9,11,13,17-heptaene |
| SMILES | C1=CC2=CC3CC=CC4CN5C=CCC6=CC(=C1)C2C(=C65)C34 |
| InChI | InChI=1S/C21H19N/c1-4-13-10-14-6-2-7-17-12-22-9-3-8-16-11-15(5-1)18(13)20(19(14)17)21(16)22/h1-5,7,9-11,14,17-19H,6,8,12H2 |
| InChIKey | ATNYZBWDCWBUPX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|