C25H22ClN3O4 — CID 87391185
[3-[8-chloro-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclobutyl] ethaneperoxoate (PubChem CID 87391185) has the molecular formula C25H22ClN3O4 and a molecular weight of 463.92 g/mol. Its IUPAC name is [3-[8-chloro-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclobutyl] ethaneperoxoate.
| Compound Name | [3-[8-chloro-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclobutyl] ethaneperoxoate |
|---|---|
| PubChem CID | 87391185 |
| Molecular Formula | C25H22ClN3O4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | [3-[8-chloro-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]cyclobutyl] ethaneperoxoate |
| SMILES | CC(=O)OOC1CC(c2nc(-c3cccc(OCc4ccccc4)c3)c3c(Cl)nccn23)C1 |
| InChI | InChI=1S/C25H22ClN3O4/c1-16(30)32-33-21-13-19(14-21)25-28-22(23-24(26)27-10-11-29(23)25)18-8-5-9-20(12-18)31-15-17-6-3-2-4-7-17/h2-12,19,21H,13-15H2,1H3 |
| InChIKey | YESYSMNSGBNFOI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|