C6H17NO10P2 — CID 87393486
[(2S)-2-amino-3-hydroxy-1-(1-phosphonooxypropan-2-yloxy)propyl] dihydrogen phosphate (PubChem CID 87393486) has the molecular formula C6H17NO10P2 and a molecular weight of 325.15 g/mol. Its IUPAC name is [(2S)-2-amino-3-hydroxy-1-(1-phosphonooxypropan-2-yloxy)propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-3-hydroxy-1-(1-phosphonooxypropan-2-yloxy)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87393486 |
| Molecular Formula | C6H17NO10P2 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [(2S)-2-amino-3-hydroxy-1-(1-phosphonooxypropan-2-yloxy)propyl] dihydrogen phosphate |
| SMILES | CC(COP(=O)(O)O)OC(OP(=O)(O)O)[C@@H](N)CO |
| InChI | InChI=1S/C6H17NO10P2/c1-4(3-15-18(9,10)11)16-6(5(7)2-8)17-19(12,13)14/h4-6,8H,2-3,7H2,1H3,(H2,9,10,11)(H2,12,13,14)/t4?,5-,6?/m0/s1 |
| InChIKey | LCLBFNMTEWOOLO-XRVVJQKQSA-N |
| XLogP | -1.74 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|