C6H17O13P3 — CID 173223866
[hydroxy-[2-hydroxy-1-(1-hydroxypropan-2-yloxy)propoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 173223866) has the molecular formula C6H17O13P3 and a molecular weight of 390.11 g/mol. Its IUPAC name is [hydroxy-[2-hydroxy-1-(1-hydroxypropan-2-yloxy)propoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[2-hydroxy-1-(1-hydroxypropan-2-yloxy)propoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 173223866 |
| Molecular Formula | C6H17O13P3 |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | [hydroxy-[2-hydroxy-1-(1-hydroxypropan-2-yloxy)propoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(CO)OC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(C)O |
| InChI | InChI=1S/C6H17O13P3/c1-4(3-7)16-6(5(2)8)17-21(12,13)19-22(14,15)18-20(9,10)11/h4-8H,3H2,1-2H3,(H,12,13)(H,14,15)(H2,9,10,11) |
| InChIKey | ZHMOXMKIWLZOPY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|