C24H16F3N5OS — CID 87393735
1-[3-(7-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazol-6-yl)phenyl]-3-(2,3,5-trifluoro-4-methylphenyl)urea (PubChem CID 87393735) has the molecular formula C24H16F3N5OS and a molecular weight of 479.49 g/mol. Its IUPAC name is 1-[3-(7-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazol-6-yl)phenyl]-3-(2,3,5-trifluoro-4-methylphenyl)urea.
| Compound Name | 1-[3-(7-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazol-6-yl)phenyl]-3-(2,3,5-trifluoro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 87393735 |
| Molecular Formula | C24H16F3N5OS |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 1-[3-(7-pyridin-4-ylpyrazolo[5,1-b][1,3]thiazol-6-yl)phenyl]-3-(2,3,5-trifluoro-4-methylphenyl)urea |
| SMILES | Cc1c(F)cc(NC(=O)Nc2cccc(-c3nn4ccsc4c3-c3ccncc3)c2)c(F)c1F |
| InChI | InChI=1S/C24H16F3N5OS/c1-13-17(25)12-18(21(27)20(13)26)30-24(33)29-16-4-2-3-15(11-16)22-19(14-5-7-28-8-6-14)23-32(31-22)9-10-34-23/h2-12H,1H3,(H2,29,30,33) |
| InChIKey | RPEYGYLHHNXJQI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|