C10H14N2OS — CID 87394991
2-[3-(1,3-thiazol-4-yl)piperidin-4-yl]acetaldehyde (PubChem CID 87394991) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-[3-(1,3-thiazol-4-yl)piperidin-4-yl]acetaldehyde.
| Compound Name | 2-[3-(1,3-thiazol-4-yl)piperidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 87394991 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-[3-(1,3-thiazol-4-yl)piperidin-4-yl]acetaldehyde |
| SMILES | O=CCC1CCNCC1c1cscn1 |
| InChI | InChI=1S/C10H14N2OS/c13-4-2-8-1-3-11-5-9(8)10-6-14-7-12-10/h4,6-9,11H,1-3,5H2 |
| InChIKey | PNTLNHXTBODTGE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|