C10H12N2OS — CID 131138402
3-cyclobutyl-4-(1,3-thiazol-4-yl)azetidin-2-one (PubChem CID 131138402) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-cyclobutyl-4-(1,3-thiazol-4-yl)azetidin-2-one.
| Compound Name | 3-cyclobutyl-4-(1,3-thiazol-4-yl)azetidin-2-one |
|---|---|
| PubChem CID | 131138402 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-cyclobutyl-4-(1,3-thiazol-4-yl)azetidin-2-one |
| SMILES | O=C1NC(c2cscn2)C1C1CCC1 |
| InChI | InChI=1S/C10H12N2OS/c13-10-8(6-2-1-3-6)9(12-10)7-4-14-5-11-7/h4-6,8-9H,1-3H2,(H,12,13) |
| InChIKey | GEZGOSCKFSCMHK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |