C10H13NOS — CID 143779714
5-cyclohexyl-1,3-thiazin-4-one (PubChem CID 143779714) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-cyclohexyl-1,3-thiazin-4-one.
| Compound Name | 5-cyclohexyl-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 143779714 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 5-cyclohexyl-1,3-thiazin-4-one |
| SMILES | O=c1ncscc1C1CCCCC1 |
| InChI | InChI=1S/C10H13NOS/c12-10-9(6-13-7-11-10)8-4-2-1-3-5-8/h6-8H,1-5H2 |
| InChIKey | MADSHZMXWFHFMF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |