C11H14N4S — CID 63021841
4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-1,3-thiazole (PubChem CID 63021841) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-1,3-thiazole.
| Compound Name | 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 63021841 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-1,3-thiazole |
| SMILES | c1nc(-c2n[nH]c(C3CCCCC3)n2)cs1 |
| InChI | InChI=1S/C11H14N4S/c1-2-4-8(5-3-1)10-13-11(15-14-10)9-6-16-7-12-9/h6-8H,1-5H2,(H,13,14,15) |
| InChIKey | KNROQNYYJLMUCE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |