C20H34O5 — CID 87398542
(5E,8E,12E)-2,2,3-trihydroxyicosa-5,8,12-trienoic acid (PubChem CID 87398542) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (5E,8E,12E)-2,2,3-trihydroxyicosa-5,8,12-trienoic acid.
| Compound Name | (5E,8E,12E)-2,2,3-trihydroxyicosa-5,8,12-trienoic acid |
|---|---|
| PubChem CID | 87398542 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (5E,8E,12E)-2,2,3-trihydroxyicosa-5,8,12-trienoic acid |
| SMILES | CCCCCCC/C=C/CC/C=C/C/C=C/CC(O)C(O)(O)C(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(21)20(24,25)19(22)23/h8-9,12-13,15-16,18,21,24-25H,2-7,10-11,14,17H2,1H3,(H,22,23)/b9-8+,13-12+,16-15+ |
| InChIKey | WWZYRFUOOPXDLL-QXFQVWHRSA-N |
| XLogP | 3.70 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|