C27H21ClFN3O5S — CID 87399388
[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3H-furan-2-ylidene]methyl methanesulfonate (PubChem CID 87399388) has the molecular formula C27H21ClFN3O5S and a molecular weight of 554.00 g/mol. Its IUPAC name is [5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3H-furan-2-ylidene]methyl methanesulfonate.
| Compound Name | [5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3H-furan-2-ylidene]methyl methanesulfonate |
|---|---|
| PubChem CID | 87399388 |
| Molecular Formula | C27H21ClFN3O5S |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | [5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3H-furan-2-ylidene]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC=C1CC=C(c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)O1 |
| InChI | InChI=1S/C27H21ClFN3O5S/c1-38(33,34)36-15-21-7-10-25(37-21)18-5-8-24-22(12-18)27(31-16-30-24)32-20-6-9-26(23(28)13-20)35-14-17-3-2-4-19(29)11-17/h2-6,8-13,15-16H,7,14H2,1H3,(H,30,31,32) |
| InChIKey | SIWZLDIPDJNTHQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|