About lithium 2-octylazepane
lithium 2-octylazepane (PubChem CID 87399886) has the molecular formula C14H28LiN
and a molecular weight of 217.33 g/mol. Its IUPAC name is lithium 2-octylazepane.
Molecular Properties
| Compound Name | lithium 2-octylazepane |
| PubChem CID | 87399886 |
| Molecular Formula | C14H28LiN |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.24 |
| IUPAC Name | lithium 2-octylazepane |
| SMILES | [CH2-]CCCCCCCC1CCCCCN1.[Li+] |
| InChI | InChI=1S/C14H28N.Li/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-15-14;/h14-15H,1-13H2;/q-1;+1 |
| InChIKey | VQGZHQAIHBBBPA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-octylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-octylazepane?
The IUPAC name of lithium 2-octylazepane (CID 87399886) is lithium 2-octylazepane.
What is the SMILES notation for lithium 2-octylazepane?
The canonical SMILES for lithium 2-octylazepane is [CH2-]CCCCCCCC1CCCCCN1.[Li+].
What is the InChIKey of lithium 2-octylazepane?
The InChIKey is VQGZHQAIHBBBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N.Li/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-15-14;/h14-15H,1-13H2;/q-1;+1.
What are the key properties of lithium 2-octylazepane?
lithium 2-octylazepane has a molecular weight of 217.33 g/mol, XLogP of 1.09, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-octylazepane is sourced from PubChem (CID 87399886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).