About formic acid;tetrapentylazanium
formic acid;tetrapentylazanium (PubChem CID 87401874) has the molecular formula C21H46NO2+
and a molecular weight of 344.60 g/mol. Its IUPAC name is formic acid;tetrapentylazanium.
Molecular Properties
| Compound Name | formic acid;tetrapentylazanium |
| PubChem CID | 87401874 |
| Molecular Formula | C21H46NO2+ |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.35 |
| IUPAC Name | formic acid;tetrapentylazanium |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.O=CO |
| InChI | InChI=1S/C20H44N.CH2O2/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;2-1-3/h5-20H2,1-4H3;1H,(H,2,3)/q+1; |
| InChIKey | LLEBPAGSRUTPHN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze formic acid;tetrapentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;tetrapentylazanium?
The IUPAC name of formic acid;tetrapentylazanium (CID 87401874) is formic acid;tetrapentylazanium.
What is the SMILES notation for formic acid;tetrapentylazanium?
The canonical SMILES for formic acid;tetrapentylazanium is CCCCC[N+](CCCCC)(CCCCC)CCCCC.O=CO.
What is the InChIKey of formic acid;tetrapentylazanium?
The InChIKey is LLEBPAGSRUTPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44N.CH2O2/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;2-1-3/h5-20H2,1-4H3;1H,(H,2,3)/q+1;.
What are the key properties of formic acid;tetrapentylazanium?
formic acid;tetrapentylazanium has a molecular weight of 344.60 g/mol, XLogP of 6.26, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;tetrapentylazanium is sourced from PubChem (CID 87401874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).