C10H12O11 — CID 87405277
3-oxobutane-1,1,4-tricarboxylic acid;propanedioic acid (PubChem CID 87405277) has the molecular formula C10H12O11 and a molecular weight of 308.20 g/mol. Its IUPAC name is 3-oxobutane-1,1,4-tricarboxylic acid;propanedioic acid.
| Compound Name | 3-oxobutane-1,1,4-tricarboxylic acid;propanedioic acid |
|---|---|
| PubChem CID | 87405277 |
| Molecular Formula | C10H12O11 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-oxobutane-1,1,4-tricarboxylic acid;propanedioic acid |
| SMILES | O=C(O)CC(=O)CC(C(=O)O)C(=O)O.O=C(O)CC(=O)O |
| InChI | InChI=1S/C7H8O7.C3H4O4/c8-3(2-5(9)10)1-4(6(11)12)7(13)14;4-2(5)1-3(6)7/h4H,1-2H2,(H,9,10)(H,11,12)(H,13,14);1H2,(H,4,5)(H,6,7) |
| InChIKey | WWTJSZZMSWBPBR-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|