C25H27N3O3 — CID 87408660
2-[5-(4-ethylpiperazin-1-yl)-2-hydroxyanilino]-4-phenylbenzoic acid (PubChem CID 87408660) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[5-(4-ethylpiperazin-1-yl)-2-hydroxyanilino]-4-phenylbenzoic acid.
| Compound Name | 2-[5-(4-ethylpiperazin-1-yl)-2-hydroxyanilino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 87408660 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[5-(4-ethylpiperazin-1-yl)-2-hydroxyanilino]-4-phenylbenzoic acid |
| SMILES | CCN1CCN(c2ccc(O)c(Nc3cc(-c4ccccc4)ccc3C(=O)O)c2)CC1 |
| InChI | InChI=1S/C25H27N3O3/c1-2-27-12-14-28(15-13-27)20-9-11-24(29)23(17-20)26-22-16-19(8-10-21(22)25(30)31)18-6-4-3-5-7-18/h3-11,16-17,26,29H,2,12-15H2,1H3,(H,30,31) |
| InChIKey | ZBOYKUUPKXVWCN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|