C20H24N4O4S — CID 87417642
3-cyclohexyl-2-(6-nitro-7-oxo-6,7a-dihydro-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 87417642) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-cyclohexyl-2-(6-nitro-7-oxo-6,7a-dihydro-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-cyclohexyl-2-(6-nitro-7-oxo-6,7a-dihydro-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 87417642 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-cyclohexyl-2-(6-nitro-7-oxo-6,7a-dihydro-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(CC1CCCCC1)N1C=C2C=CC([N+](=O)[O-])C(=O)C2C1 |
| InChI | InChI=1S/C20H24N4O4S/c25-18-15-12-23(11-14(15)6-7-16(18)24(27)28)17(10-13-4-2-1-3-5-13)19(26)22-20-21-8-9-29-20/h6-9,11,13,15-17H,1-5,10,12H2,(H,21,22,26) |
| InChIKey | RDDSJZIZMDORST-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|