C20H17N5O2 — CID 87417710
N-[[1-[3-(pyrimidin-4-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methylidene]hydroxylamine (PubChem CID 87417710) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[[1-[3-(pyrimidin-4-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methylidene]hydroxylamine.
| Compound Name | N-[[1-[3-(pyrimidin-4-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87417710 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[[1-[3-(pyrimidin-4-ylmethoxymethyl)phenyl]benzimidazol-5-yl]methylidene]hydroxylamine |
| SMILES | ON=Cc1ccc2c(c1)ncn2-c1cccc(COCc2ccncn2)c1 |
| InChI | InChI=1S/C20H17N5O2/c26-24-10-15-4-5-20-19(9-15)23-14-25(20)18-3-1-2-16(8-18)11-27-12-17-6-7-21-13-22-17/h1-10,13-14,26H,11-12H2 |
| InChIKey | ZGVPSPOWOVWTJP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|