C19H16N6OS — CID 12001588
2-[[3-[5-(azidomethyl)benzimidazol-1-yl]phenyl]methoxymethyl]-1,3-thiazole (PubChem CID 12001588) has the molecular formula C19H16N6OS and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[[3-[5-(azidomethyl)benzimidazol-1-yl]phenyl]methoxymethyl]-1,3-thiazole.
| Compound Name | 2-[[3-[5-(azidomethyl)benzimidazol-1-yl]phenyl]methoxymethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 12001588 |
| Molecular Formula | C19H16N6OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-[[3-[5-(azidomethyl)benzimidazol-1-yl]phenyl]methoxymethyl]-1,3-thiazole |
| SMILES | [N-]=[N+]=NCc1ccc2c(c1)ncn2-c1cccc(COCc2nccs2)c1 |
| InChI | InChI=1S/C19H16N6OS/c20-24-23-10-14-4-5-18-17(9-14)22-13-25(18)16-3-1-2-15(8-16)11-26-12-19-21-6-7-27-19/h1-9,13H,10-12H2 |
| InChIKey | HDQOLXLXSKFLEM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|