C33H28N6O2S2 — CID 159602805
[3-amino-4-[3-(1,3-thiazol-2-yl)anilino]phenyl]methanol;[1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-5-yl]methanol (PubChem CID 159602805) has the molecular formula C33H28N6O2S2 and a molecular weight of 604.76 g/mol. Its IUPAC name is [3-amino-4-[3-(1,3-thiazol-2-yl)anilino]phenyl]methanol;[1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-5-yl]methanol.
| Compound Name | [3-amino-4-[3-(1,3-thiazol-2-yl)anilino]phenyl]methanol;[1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 159602805 |
| Molecular Formula | C33H28N6O2S2 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | [3-amino-4-[3-(1,3-thiazol-2-yl)anilino]phenyl]methanol;[1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-5-yl]methanol |
| SMILES | Nc1cc(CO)ccc1Nc1cccc(-c2nccs2)c1.OCc1ccc2c(c1)ncn2-c1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C17H13N3OS.C16H15N3OS/c21-10-12-4-5-16-15(8-12)19-11-20(16)14-3-1-2-13(9-14)17-18-6-7-22-17;17-14-8-11(10-20)4-5-15(14)19-13-3-1-2-12(9-13)16-18-6-7-21-16/h1-9,11,21H,10H2;1-9,19-20H,10,17H2 |
| InChIKey | MLRUOWPXXKZOSH-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|