C17H14N4S — CID 90700681
[1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-2-yl]methanamine (PubChem CID 90700681) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is [1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-2-yl]methanamine.
| Compound Name | [1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 90700681 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [1-[3-(1,3-thiazol-2-yl)phenyl]benzimidazol-2-yl]methanamine |
| SMILES | NCc1nc2ccccc2n1-c1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C17H14N4S/c18-11-16-20-14-6-1-2-7-15(14)21(16)13-5-3-4-12(10-13)17-19-8-9-22-17/h1-10H,11,18H2 |
| InChIKey | ZSJQEOHWLAFPQR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |