C19H24N2O3S2 — CID 87420205
2-[[2-[6-(4-ethoxyphenyl)hex-1-en-2-ylamino]-1,3-thiazol-5-yl]sulfanyl]acetic acid (PubChem CID 87420205) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[[2-[6-(4-ethoxyphenyl)hex-1-en-2-ylamino]-1,3-thiazol-5-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[2-[6-(4-ethoxyphenyl)hex-1-en-2-ylamino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 87420205 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[[2-[6-(4-ethoxyphenyl)hex-1-en-2-ylamino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
| SMILES | C=C(CCCCc1ccc(OCC)cc1)Nc1ncc(SCC(=O)O)s1 |
| InChI | InChI=1S/C19H24N2O3S2/c1-3-24-16-10-8-15(9-11-16)7-5-4-6-14(2)21-19-20-12-18(26-19)25-13-17(22)23/h8-12H,2-7,13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ZWGRNPGRNTZMLD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|