C19H18N2OS2 — CID 88549047
N-(5-benzylsulfanyl-1,3-thiazol-2-yl)-3-phenylpropanamide (PubChem CID 88549047) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3-thiazol-2-yl)-3-phenylpropanamide.
| Compound Name | N-(5-benzylsulfanyl-1,3-thiazol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 88549047 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3-thiazol-2-yl)-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ncc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C19H18N2OS2/c22-17(12-11-15-7-3-1-4-8-15)21-19-20-13-18(24-19)23-14-16-9-5-2-6-10-16/h1-10,13H,11-12,14H2,(H,20,21,22) |
| InChIKey | PHCPPMJEJJPZPG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |