C6H6Br4O — CID 87429937
3,3-dibromo-3-(1,1-dibromoprop-2-enoxy)prop-1-ene (PubChem CID 87429937) has the molecular formula C6H6Br4O and a molecular weight of 413.73 g/mol. Its IUPAC name is 3,3-dibromo-3-(1,1-dibromoprop-2-enoxy)prop-1-ene.
| Compound Name | 3,3-dibromo-3-(1,1-dibromoprop-2-enoxy)prop-1-ene |
|---|---|
| PubChem CID | 87429937 |
| Molecular Formula | C6H6Br4O |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 409.72 |
| IUPAC Name | 3,3-dibromo-3-(1,1-dibromoprop-2-enoxy)prop-1-ene |
| SMILES | C=CC(Br)(Br)OC(Br)(Br)C=C |
| InChI | InChI=1S/C6H6Br4O/c1-3-5(7,8)11-6(9,10)4-2/h3-4H,1-2H2 |
| InChIKey | VOCDLPBMKBWOSM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|