C19H17ClN2O5S2 — CID 87432476
carbonic acid;5-(6-chloro-3-pyridinyl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide (PubChem CID 87432476) has the molecular formula C19H17ClN2O5S2 and a molecular weight of 452.94 g/mol. Its IUPAC name is carbonic acid;5-(6-chloro-3-pyridinyl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide.
| Compound Name | carbonic acid;5-(6-chloro-3-pyridinyl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 87432476 |
| Molecular Formula | C19H17ClN2O5S2 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | carbonic acid;5-(6-chloro-3-pyridinyl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide |
| SMILES | O=C(O)O.O=S(=O)(N[C@H]1C[C@@H]1c1ccccc1)c1ccc(-c2ccc(Cl)nc2)s1 |
| InChI | InChI=1S/C18H15ClN2O2S2.CH2O3/c19-17-8-6-13(11-20-17)16-7-9-18(24-16)25(22,23)21-15-10-14(15)12-4-2-1-3-5-12;2-1(3)4/h1-9,11,14-15,21H,10H2;(H2,2,3,4)/t14-,15+;/m1./s1 |
| InChIKey | YEZAUZKBTXAEBO-LIOBNPLQSA-N |
| XLogP | 4.52 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|