About 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide
5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide (PubChem CID 67525356) has the molecular formula C17H16N2O3S2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide |
| PubChem CID | 67525356 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)N[C@H]3C[C@@H]3c3ccccc3)s2)no1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-11-9-15(18-22-11)16-7-8-17(23-16)24(20,21)19-14-10-13(14)12-5-3-2-4-6-12/h2-9,13-14,19H,10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | QWLOGPWVLKEKSP-KGLIPLIRSA-N |
| XLogP | 3.55 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide?
The IUPAC name of 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide (CID 67525356) is 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide is Cc1cc(-c2ccc(S(=O)(=O)N[C@H]3C[C@@H]3c3ccccc3)s2)no1.
What is the InChIKey of 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide?
The InChIKey is QWLOGPWVLKEKSP-KGLIPLIRSA-N. The full InChI is InChI=1S/C17H16N2O3S2/c1-11-9-15(18-22-11)16-7-8-17(23-16)24(20,21)19-14-10-13(14)12-5-3-2-4-6-12/h2-9,13-14,19H,10H2,1H3/t13-,14+/m1/s1.
What are the key properties of 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide?
5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide has a molecular weight of 360.46 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methyl-1,2-oxazol-3-yl)-N-[(1S,2R)-2-phenylcyclopropyl]thiophene-2-sulfonamide is sourced from PubChem (CID 67525356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).