C18H20BrClN2O2S — CID 11744144
N-[(1R,2R,4R)-4-bromo-2-(6-chloro-3-pyridinyl)cyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 11744144) has the molecular formula C18H20BrClN2O2S and a molecular weight of 443.79 g/mol. Its IUPAC name is N-[(1R,2R,4R)-4-bromo-2-(6-chloro-3-pyridinyl)cyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R,4R)-4-bromo-2-(6-chloro-3-pyridinyl)cyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11744144 |
| Molecular Formula | C18H20BrClN2O2S |
| Molecular Weight | 443.79 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | N-[(1R,2R,4R)-4-bromo-2-(6-chloro-3-pyridinyl)cyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CC[C@@H](Br)C[C@@H]2c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C18H20BrClN2O2S/c1-12-2-6-15(7-3-12)25(23,24)22-17-8-5-14(19)10-16(17)13-4-9-18(20)21-11-13/h2-4,6-7,9,11,14,16-17,22H,5,8,10H2,1H3/t14-,16-,17-/m1/s1 |
| InChIKey | QDAGDRCHHFZNHZ-DJIMGWMZSA-N |
| XLogP | 4.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|