C15H21NO4S — CID 87433842
pyrrolidin-3-yl 3-(2,3-dihydro-1-benzofuran-5-yl)propane-1-sulfonate (PubChem CID 87433842) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is pyrrolidin-3-yl 3-(2,3-dihydro-1-benzofuran-5-yl)propane-1-sulfonate.
| Compound Name | pyrrolidin-3-yl 3-(2,3-dihydro-1-benzofuran-5-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 87433842 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | pyrrolidin-3-yl 3-(2,3-dihydro-1-benzofuran-5-yl)propane-1-sulfonate |
| SMILES | O=S(=O)(CCCc1ccc2c(c1)CCO2)OC1CCNC1 |
| InChI | InChI=1S/C15H21NO4S/c17-21(18,20-14-5-7-16-11-14)9-1-2-12-3-4-15-13(10-12)6-8-19-15/h3-4,10,14,16H,1-2,5-9,11H2 |
| InChIKey | SKBZKHBMVUWHGD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|