C4H11N2O7PS — CID 87434750
(2R)-2-amino-3-(phosphonomethylsulfamoyl)propanoic acid (PubChem CID 87434750) has the molecular formula C4H11N2O7PS and a molecular weight of 262.18 g/mol. Its IUPAC name is (2R)-2-amino-3-(phosphonomethylsulfamoyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(phosphonomethylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 87434750 |
| Molecular Formula | C4H11N2O7PS |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | (2R)-2-amino-3-(phosphonomethylsulfamoyl)propanoic acid |
| SMILES | N[C@@H](CS(=O)(=O)NCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C4H11N2O7PS/c5-3(4(7)8)1-15(12,13)6-2-14(9,10)11/h3,6H,1-2,5H2,(H,7,8)(H2,9,10,11)/t3-/m0/s1 |
| InChIKey | YJOBOFIUPBECCS-VKHMYHEASA-N |
| XLogP | -2.55 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|