C10H12F4N2O6 — CID 87438760
2-[[4-(1-carboxyethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoyl]amino]propanoic acid (PubChem CID 87438760) has the molecular formula C10H12F4N2O6 and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-[[4-(1-carboxyethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | 2-[[4-(1-carboxyethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87438760 |
| Molecular Formula | C10H12F4N2O6 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-[[4-(1-carboxyethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(=O)NC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H12F4N2O6/c1-3(5(17)18)15-7(21)9(11,12)10(13,14)8(22)16-4(2)6(19)20/h3-4H,1-2H3,(H,15,21)(H,16,22)(H,17,18)(H,19,20) |
| InChIKey | AUGQXIPLLRFKLK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|