C8H16N2O2S — CID 87439577
O-(morpholin-4-ylmethyl) N,N-dimethylcarbamothioate (PubChem CID 87439577) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is O-(morpholin-4-ylmethyl) N,N-dimethylcarbamothioate.
| Compound Name | O-(morpholin-4-ylmethyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 87439577 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | O-(morpholin-4-ylmethyl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)OCN1CCOCC1 |
| InChI | InChI=1S/C8H16N2O2S/c1-9(2)8(13)12-7-10-3-5-11-6-4-10/h3-7H2,1-2H3 |
| InChIKey | GRLAKVDSAQJMNW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|