C9H8ClNO4S — CID 87440400
4-(5-chlorothiophen-2-yl)-3-formamido-4-oxobutanoic acid (PubChem CID 87440400) has the molecular formula C9H8ClNO4S and a molecular weight of 261.69 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-3-formamido-4-oxobutanoic acid.
| Compound Name | 4-(5-chlorothiophen-2-yl)-3-formamido-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87440400 |
| Molecular Formula | C9H8ClNO4S |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-3-formamido-4-oxobutanoic acid |
| SMILES | O=CNC(CC(=O)O)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H8ClNO4S/c10-7-2-1-6(16-7)9(15)5(11-4-12)3-8(13)14/h1-2,4-5H,3H2,(H,11,12)(H,13,14) |
| InChIKey | XEANYZWRBUFVMO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|